C26H34FeN3- — CID 169018191
carbanide;N-[(6R)-2,6-dimethylcyclohexa-1,3-dien-1-yl]-1-[6-[N-[(6S)-2,6-dimethylcyclohexa-1,3-dien-1-yl]-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine;iron (PubChem CID 169018191) has the molecular formula C26H34FeN3- and a molecular weight of 444.42 g/mol. Its IUPAC name is carbanide;N-[(6R)-2,6-dimethylcyclohexa-1,3-dien-1-yl]-1-[6-[N-[(6S)-2,6-dimethylcyclohexa-1,3-dien-1-yl]-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine;iron.
| Compound Name | carbanide;N-[(6R)-2,6-dimethylcyclohexa-1,3-dien-1-yl]-1-[6-[N-[(6S)-2,6-dimethylcyclohexa-1,3-dien-1-yl]-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine;iron |
|---|---|
| PubChem CID | 169018191 |
| Molecular Formula | C26H34FeN3- |
| Molecular Weight | 444.42 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | carbanide;N-[(6R)-2,6-dimethylcyclohexa-1,3-dien-1-yl]-1-[6-[N-[(6S)-2,6-dimethylcyclohexa-1,3-dien-1-yl]-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine;iron |
| SMILES | CC1=C(/N=C(\C)c2cccc(/C(C)=N/C3=C(C)C=CC[C@@H]3C)n2)[C@H](C)CC=C1.[CH3-].[Fe] |
| InChI | InChI=1S/C25H31N3.CH3.Fe/c1-16-10-7-11-17(2)24(16)26-20(5)22-14-9-15-23(28-22)21(6)27-25-18(3)12-8-13-19(25)4;;/h7-10,12,14-15,17,19H,11,13H2,1-6H3;1H3;/q;-1;/b26-20+,27-21+;;/t17-,19+;; |
| InChIKey | HUXUUXALKLBUGP-ZJDXJODASA-N |
| XLogP | 6.89 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.42 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|