C8H17NO — CID 169020554
[(2S)-1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyrrolidin-2-yl]methanol (PubChem CID 169020554) has the molecular formula C8H17NO and a molecular weight of 150.27 g/mol. Its IUPAC name is [(2S)-1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 169020554 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 150.27 g/mol |
| Exact Mass | 150.17 |
| IUPAC Name | [(2S)-1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyrrolidin-2-yl]methanol |
| SMILES | [2H]C([2H])([2H])C([2H])(N1CCC[C@H]1CO)C([2H])([2H])[2H] |
| InChI | InChI=1S/C8H17NO/c1-7(2)9-5-3-4-8(9)6-10/h7-8,10H,3-6H2,1-2H3/t8-/m0/s1/i1D3,2D3,7D |
| InChIKey | XJCUYISZYNEDKN-JMNAMWTNSA-N |
| XLogP | 0.85 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.27 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |