C46H48F2N8O5 — CID 169020787
N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-4-[4-[3-[1-(2,6-dioxopiperidin-3-yl)indol-4-yl]oxypropyl]piperazin-1-yl]-2-(oxan-4-ylamino)benzamide (PubChem CID 169020787) has the molecular formula C46H48F2N8O5 and a molecular weight of 830.94 g/mol. Its IUPAC name is N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-4-[4-[3-[1-(2,6-dioxopiperidin-3-yl)indol-4-yl]oxypropyl]piperazin-1-yl]-2-(oxan-4-ylamino)benzamide.
| Compound Name | N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-4-[4-[3-[1-(2,6-dioxopiperidin-3-yl)indol-4-yl]oxypropyl]piperazin-1-yl]-2-(oxan-4-ylamino)benzamide |
|---|---|
| PubChem CID | 169020787 |
| Molecular Formula | C46H48F2N8O5 |
| Molecular Weight | 830.94 g/mol |
| Exact Mass | 830.37 |
| IUPAC Name | N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-4-[4-[3-[1-(2,6-dioxopiperidin-3-yl)indol-4-yl]oxypropyl]piperazin-1-yl]-2-(oxan-4-ylamino)benzamide |
| SMILES | O=C1CCC(n2ccc3c(OCCCN4CCN(c5ccc(C(=O)Nc6n[nH]c7ccc(Cc8cc(F)cc(F)c8)cc67)c(NC6CCOCC6)c5)CC4)cccc32)C(=O)N1 |
| InChI | InChI=1S/C46H48F2N8O5/c47-31-24-30(25-32(48)27-31)23-29-5-8-38-37(26-29)44(53-52-38)51-45(58)35-7-6-34(28-39(35)49-33-12-21-60-22-13-33)55-18-16-54(17-19-55)14-2-20-61-42-4-1-3-40-36(42)11-15-56(40)41-9-10-43(57)50-46(41)59/h1,3-8,11,15,24-28,33,41,49H,2,9-10,12-14,16-23H2,(H,50,57,59)(H2,51,52,53,58) |
| InChIKey | BIVTXNHRFOZCOV-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 145.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.94 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|