C16H17F2N5O3 — CID 169021414
2-(3,6-difluoro-5-isocyano-2-pyridinyl)-4-ethyl-5-(oxan-2-yloxymethyl)-1,2,4-triazol-3-one (PubChem CID 169021414) has the molecular formula C16H17F2N5O3 and a molecular weight of 365.34 g/mol. Its IUPAC name is 2-(3,6-difluoro-5-isocyano-2-pyridinyl)-4-ethyl-5-(oxan-2-yloxymethyl)-1,2,4-triazol-3-one.
| Compound Name | 2-(3,6-difluoro-5-isocyano-2-pyridinyl)-4-ethyl-5-(oxan-2-yloxymethyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 169021414 |
| Molecular Formula | C16H17F2N5O3 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 2-(3,6-difluoro-5-isocyano-2-pyridinyl)-4-ethyl-5-(oxan-2-yloxymethyl)-1,2,4-triazol-3-one |
| SMILES | [C-]#[N+]c1cc(F)c(-n2nc(COC3CCCCO3)n(CC)c2=O)nc1F |
| InChI | InChI=1S/C16H17F2N5O3/c1-3-22-12(9-26-13-6-4-5-7-25-13)21-23(16(22)24)15-10(17)8-11(19-2)14(18)20-15/h8,13H,3-7,9H2,1H3 |
| InChIKey | QYNMDWZUMQNRLN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 75.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|