C44H43ClN6O6 — CID 169022583
5-[4-[4-[2-[4-[3-(3-chloro-4-isocyanophenoxy)piperidine-1-carbonyl]phenyl]ethynyl]piperidin-1-yl]piperidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 169022583) has the molecular formula C44H43ClN6O6 and a molecular weight of 787.32 g/mol. Its IUPAC name is 5-[4-[4-[2-[4-[3-(3-chloro-4-isocyanophenoxy)piperidine-1-carbonyl]phenyl]ethynyl]piperidin-1-yl]piperidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[4-[4-[2-[4-[3-(3-chloro-4-isocyanophenoxy)piperidine-1-carbonyl]phenyl]ethynyl]piperidin-1-yl]piperidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 169022583 |
| Molecular Formula | C44H43ClN6O6 |
| Molecular Weight | 787.32 g/mol |
| Exact Mass | 786.29 |
| IUPAC Name | 5-[4-[4-[2-[4-[3-(3-chloro-4-isocyanophenoxy)piperidine-1-carbonyl]phenyl]ethynyl]piperidin-1-yl]piperidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | [C-]#[N+]c1ccc(OC2CCCN(C(=O)c3ccc(C#CC4CCN(C5CCN(c6ccc7c(c6)C(=O)N(C6CCC(=O)NC6=O)C7=O)CC5)CC4)cc3)C2)cc1Cl |
| InChI | InChI=1S/C44H43ClN6O6/c1-46-38-13-11-33(26-37(38)45)57-34-3-2-20-50(27-34)42(54)30-8-6-28(7-9-30)4-5-29-16-21-48(22-17-29)31-18-23-49(24-19-31)32-10-12-35-36(25-32)44(56)51(43(35)55)39-14-15-40(52)47-41(39)53/h6-13,25-26,29,31,34,39H,2-3,14-24,27H2,(H,47,52,53) |
| InChIKey | ZCHMFNOFNCXBHC-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.32 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|