C13H11ClN3O2- — CID 169022950
N-(3-chlorophenyl)-N-[4-(oxidoamino)-2-pyridinyl]acetamide (PubChem CID 169022950) has the molecular formula C13H11ClN3O2- and a molecular weight of 276.70 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N-[4-(oxidoamino)-2-pyridinyl]acetamide.
| Compound Name | N-(3-chlorophenyl)-N-[4-(oxidoamino)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 169022950 |
| Molecular Formula | C13H11ClN3O2- |
| Molecular Weight | 276.70 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | N-(3-chlorophenyl)-N-[4-(oxidoamino)-2-pyridinyl]acetamide |
| SMILES | CC(=O)N(c1cccc(Cl)c1)c1cc(N[O-])ccn1 |
| InChI | InChI=1S/C13H11ClN3O2/c1-9(18)17(12-4-2-3-10(14)7-12)13-8-11(16-19)5-6-15-13/h2-8H,1H3,(H-,15,16,19)/q-1 |
| InChIKey | ONDIMGANJBJWOU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.70 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|