About tris(pyrrolidin-1-ide);titanium(4+);3,4,5-trimethylpyrazol-1-ide
tris(pyrrolidin-1-ide);titanium(4+);3,4,5-trimethylpyrazol-1-ide (PubChem CID 169023747) has the molecular formula C18H33N5Ti
and a molecular weight of 367.36 g/mol. Its IUPAC name is tris(pyrrolidin-1-ide);titanium(4+);3,4,5-trimethylpyrazol-1-ide.
Molecular Properties
| Compound Name | tris(pyrrolidin-1-ide);titanium(4+);3,4,5-trimethylpyrazol-1-ide |
| PubChem CID | 169023747 |
| Molecular Formula | C18H33N5Ti |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | tris(pyrrolidin-1-ide);titanium(4+);3,4,5-trimethylpyrazol-1-ide |
| SMILES | C1CC[N-]C1.C1CC[N-]C1.C1CC[N-]C1.Cc1n[n-]c(C)c1C.[Ti+4] |
| InChI | InChI=1S/C6H9N2.3C4H8N.Ti/c1-4-5(2)7-8-6(4)3;3*1-2-4-5-3-1;/h1-3H3;3*1-4H2;/q4*-1;+4 |
| InChIKey | ISFFHQOLIBHBKA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 69.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze tris(pyrrolidin-1-ide);titanium(4+);3,4,5-trimethylpyrazol-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(pyrrolidin-1-ide);titanium(4+);3,4,5-trimethylpyrazol-1-ide?
The IUPAC name of tris(pyrrolidin-1-ide);titanium(4+);3,4,5-trimethylpyrazol-1-ide (CID 169023747) is tris(pyrrolidin-1-ide);titanium(4+);3,4,5-trimethylpyrazol-1-ide.
What is the SMILES notation for tris(pyrrolidin-1-ide);titanium(4+);3,4,5-trimethylpyrazol-1-ide?
The canonical SMILES for tris(pyrrolidin-1-ide);titanium(4+);3,4,5-trimethylpyrazol-1-ide is C1CC[N-]C1.C1CC[N-]C1.C1CC[N-]C1.Cc1n[n-]c(C)c1C.[Ti+4].
What is the InChIKey of tris(pyrrolidin-1-ide);titanium(4+);3,4,5-trimethylpyrazol-1-ide?
The InChIKey is ISFFHQOLIBHBKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N2.3C4H8N.Ti/c1-4-5(2)7-8-6(4)3;3*1-2-4-5-3-1;/h1-3H3;3*1-4H2;/q4*-1;+4.
What are the key properties of tris(pyrrolidin-1-ide);titanium(4+);3,4,5-trimethylpyrazol-1-ide?
tris(pyrrolidin-1-ide);titanium(4+);3,4,5-trimethylpyrazol-1-ide has a molecular weight of 367.36 g/mol, XLogP of 4.42, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tris(pyrrolidin-1-ide);titanium(4+);3,4,5-trimethylpyrazol-1-ide is sourced from PubChem (CID 169023747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).