About 5-methyl-3-propan-2-ylpyrazol-1-ide;tris(pyrrolidin-1-ide);titanium(4+)
5-methyl-3-propan-2-ylpyrazol-1-ide;tris(pyrrolidin-1-ide);titanium(4+) (PubChem CID 169023756) has the molecular formula C19H35N5Ti
and a molecular weight of 381.39 g/mol. Its IUPAC name is 5-methyl-3-propan-2-ylpyrazol-1-ide;tris(pyrrolidin-1-ide);titanium(4+).
Molecular Properties
| Compound Name | 5-methyl-3-propan-2-ylpyrazol-1-ide;tris(pyrrolidin-1-ide);titanium(4+) |
| PubChem CID | 169023756 |
| Molecular Formula | C19H35N5Ti |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 5-methyl-3-propan-2-ylpyrazol-1-ide;tris(pyrrolidin-1-ide);titanium(4+) |
| SMILES | C1CC[N-]C1.C1CC[N-]C1.C1CC[N-]C1.Cc1cc(C(C)C)n[n-]1.[Ti+4] |
| InChI | InChI=1S/C7H11N2.3C4H8N.Ti/c1-5(2)7-4-6(3)8-9-7;3*1-2-4-5-3-1;/h4-5H,1-3H3;3*1-4H2;/q4*-1;+4 |
| InChIKey | OGIXEDJELAHBOF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 69.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-methyl-3-propan-2-ylpyrazol-1-ide;tris(pyrrolidin-1-ide);titanium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-propan-2-ylpyrazol-1-ide;tris(pyrrolidin-1-ide);titanium(4+)?
The IUPAC name of 5-methyl-3-propan-2-ylpyrazol-1-ide;tris(pyrrolidin-1-ide);titanium(4+) (CID 169023756) is 5-methyl-3-propan-2-ylpyrazol-1-ide;tris(pyrrolidin-1-ide);titanium(4+).
What is the SMILES notation for 5-methyl-3-propan-2-ylpyrazol-1-ide;tris(pyrrolidin-1-ide);titanium(4+)?
The canonical SMILES for 5-methyl-3-propan-2-ylpyrazol-1-ide;tris(pyrrolidin-1-ide);titanium(4+) is C1CC[N-]C1.C1CC[N-]C1.C1CC[N-]C1.Cc1cc(C(C)C)n[n-]1.[Ti+4].
What is the InChIKey of 5-methyl-3-propan-2-ylpyrazol-1-ide;tris(pyrrolidin-1-ide);titanium(4+)?
The InChIKey is OGIXEDJELAHBOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N2.3C4H8N.Ti/c1-5(2)7-4-6(3)8-9-7;3*1-2-4-5-3-1;/h4-5H,1-3H3;3*1-4H2;/q4*-1;+4.
What are the key properties of 5-methyl-3-propan-2-ylpyrazol-1-ide;tris(pyrrolidin-1-ide);titanium(4+)?
5-methyl-3-propan-2-ylpyrazol-1-ide;tris(pyrrolidin-1-ide);titanium(4+) has a molecular weight of 381.39 g/mol, XLogP of 4.93, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-propan-2-ylpyrazol-1-ide;tris(pyrrolidin-1-ide);titanium(4+) is sourced from PubChem (CID 169023756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).