About 1-(2-methylpropyl)-5,5a-dihydroimidazo[4,5-c]quinolin-4-amine
1-(2-methylpropyl)-5,5a-dihydroimidazo[4,5-c]quinolin-4-amine (PubChem CID 169024403) has the molecular formula C14H18N4
and a molecular weight of 242.33 g/mol. Its IUPAC name is 1-(2-methylpropyl)-5,5a-dihydroimidazo[4,5-c]quinolin-4-amine.
Molecular Properties
| Compound Name | 1-(2-methylpropyl)-5,5a-dihydroimidazo[4,5-c]quinolin-4-amine |
| PubChem CID | 169024403 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 1-(2-methylpropyl)-5,5a-dihydroimidazo[4,5-c]quinolin-4-amine |
| SMILES | CC(C)Cn1cnc2c1=C1C=CC=CC1NC=2N |
| InChI | InChI=1S/C14H18N4/c1-9(2)7-18-8-16-12-13(18)10-5-3-4-6-11(10)17-14(12)15/h3-6,8-9,11,17H,7,15H2,1-2H3 |
| InChIKey | KYRIVUVUXJRQLJ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-methylpropyl)-5,5a-dihydroimidazo[4,5-c]quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylpropyl)-5,5a-dihydroimidazo[4,5-c]quinolin-4-amine?
The IUPAC name of 1-(2-methylpropyl)-5,5a-dihydroimidazo[4,5-c]quinolin-4-amine (CID 169024403) is 1-(2-methylpropyl)-5,5a-dihydroimidazo[4,5-c]quinolin-4-amine.
What is the SMILES notation for 1-(2-methylpropyl)-5,5a-dihydroimidazo[4,5-c]quinolin-4-amine?
The canonical SMILES for 1-(2-methylpropyl)-5,5a-dihydroimidazo[4,5-c]quinolin-4-amine is CC(C)Cn1cnc2c1=C1C=CC=CC1NC=2N.
What is the InChIKey of 1-(2-methylpropyl)-5,5a-dihydroimidazo[4,5-c]quinolin-4-amine?
The InChIKey is KYRIVUVUXJRQLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4/c1-9(2)7-18-8-16-12-13(18)10-5-3-4-6-11(10)17-14(12)15/h3-6,8-9,11,17H,7,15H2,1-2H3.
What are the key properties of 1-(2-methylpropyl)-5,5a-dihydroimidazo[4,5-c]quinolin-4-amine?
1-(2-methylpropyl)-5,5a-dihydroimidazo[4,5-c]quinolin-4-amine has a molecular weight of 242.33 g/mol, XLogP of -0.19, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylpropyl)-5,5a-dihydroimidazo[4,5-c]quinolin-4-amine is sourced from PubChem (CID 169024403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).