About CID 169025643
CID 169025643 (PubChem CID 169025643) has the molecular formula C39H31F3IrN2O-2
and a molecular weight of 798.94 g/mol.
Molecular Properties
| Compound Name | CID 169025643 |
| PubChem CID | 169025643 |
| Molecular Formula | C39H31F3IrN2O-2 |
| Molecular Weight | 798.94 g/mol |
| Exact Mass | 799.24 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-c2[c-]ccc3c2Oc2c(C(F)(F)F)ccc4cccc-3c24)c1.[2H]C([2H])([2H])c1c[c-]c(-c2ccc(C([2H])([2H])[2H])cn2)cc1.[Ir] |
| InChI | InChI=1S/C26H19F3NO.C13H12N.Ir/c1-25(2,3)16-12-13-30-21(14-16)19-9-5-8-18-17-7-4-6-15-10-11-20(26(27,28)29)24(22(15)17)31-23(18)19;1-10-3-6-12(7-4-10)13-8-5-11(2)9-14-13;/h4-8,10-14H,1-3H3;3-6,8-9H,1-2H3;/q2*-1;/i;1D3,2D3; |
| InChIKey | KKHMJVREWLOXMS-RUHQGNAASA-N |
| XLogP | 10.95 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 798.94 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 169025643 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169025643?
The IUPAC name of CID 169025643 (CID 169025643) is not available.
What is the SMILES notation for CID 169025643?
The canonical SMILES for CID 169025643 is CC(C)(C)c1ccnc(-c2[c-]ccc3c2Oc2c(C(F)(F)F)ccc4cccc-3c24)c1.[2H]C([2H])([2H])c1c[c-]c(-c2ccc(C([2H])([2H])[2H])cn2)cc1.[Ir].
What is the InChIKey of CID 169025643?
The InChIKey is KKHMJVREWLOXMS-RUHQGNAASA-N. The full InChI is InChI=1S/C26H19F3NO.C13H12N.Ir/c1-25(2,3)16-12-13-30-21(14-16)19-9-5-8-18-17-7-4-6-15-10-11-20(26(27,28)29)24(22(15)17)31-23(18)19;1-10-3-6-12(7-4-10)13-8-5-11(2)9-14-13;/h4-8,10-14H,1-3H3;3-6,8-9H,1-2H3;/q2*-1;/i;1D3,2D3;.
What are the key properties of CID 169025643?
CID 169025643 has a molecular weight of 798.94 g/mol, XLogP of 10.95, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169025643 is sourced from PubChem (CID 169025643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).