C21H23FN4 — CID 169026161
7-fluoro-2-(5-piperidin-1-yl-2-pyridinyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 169026161) has the molecular formula C21H23FN4 and a molecular weight of 350.44 g/mol. Its IUPAC name is 7-fluoro-2-(5-piperidin-1-yl-2-pyridinyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 7-fluoro-2-(5-piperidin-1-yl-2-pyridinyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 169026161 |
| Molecular Formula | C21H23FN4 |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 7-fluoro-2-(5-piperidin-1-yl-2-pyridinyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | Fc1ccc2c3c([nH]c2c1)CN(c1ccc(N2CCCCC2)cn1)CC3 |
| InChI | InChI=1S/C21H23FN4/c22-15-4-6-17-18-8-11-26(14-20(18)24-19(17)12-15)21-7-5-16(13-23-21)25-9-2-1-3-10-25/h4-7,12-13,24H,1-3,8-11,14H2 |
| InChIKey | NCANPFHSOPTMBO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|