C19H22O5 — CID 169026784
(6E,8E,10E)-1-(4-methoxy-5-methylidene-2-oxofuran-3-yl)-3-methyldodeca-6,8,10-triene-1,5-dione (PubChem CID 169026784) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is (6E,8E,10E)-1-(4-methoxy-5-methylidene-2-oxofuran-3-yl)-3-methyldodeca-6,8,10-triene-1,5-dione.
| Compound Name | (6E,8E,10E)-1-(4-methoxy-5-methylidene-2-oxofuran-3-yl)-3-methyldodeca-6,8,10-triene-1,5-dione |
|---|---|
| PubChem CID | 169026784 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (6E,8E,10E)-1-(4-methoxy-5-methylidene-2-oxofuran-3-yl)-3-methyldodeca-6,8,10-triene-1,5-dione |
| SMILES | C=C1OC(=O)C(C(=O)CC(C)CC(=O)/C=C/C=C/C=C/C)=C1OC |
| InChI | InChI=1S/C19H22O5/c1-5-6-7-8-9-10-15(20)11-13(2)12-16(21)17-18(23-4)14(3)24-19(17)22/h5-10,13H,3,11-12H2,1-2,4H3/b6-5+,8-7+,10-9+ |
| InChIKey | FEBPBQAQCRNHKM-SUTYWZMXSA-N |
| XLogP | 3.20 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|