C11H8Cl4N2O — CID 169027247
N-(1,2,2,2-tetrachloroethyl)-1H-indole-3-carboxamide (PubChem CID 169027247) has the molecular formula C11H8Cl4N2O and a molecular weight of 326.01 g/mol. Its IUPAC name is N-(1,2,2,2-tetrachloroethyl)-1H-indole-3-carboxamide.
| Compound Name | N-(1,2,2,2-tetrachloroethyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 169027247 |
| Molecular Formula | C11H8Cl4N2O |
| Molecular Weight | 326.01 g/mol |
| Exact Mass | 323.94 |
| IUPAC Name | N-(1,2,2,2-tetrachloroethyl)-1H-indole-3-carboxamide |
| SMILES | O=C(NC(Cl)C(Cl)(Cl)Cl)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C11H8Cl4N2O/c12-10(11(13,14)15)17-9(18)7-5-16-8-4-2-1-3-6(7)8/h1-5,10,16H,(H,17,18) |
| InChIKey | PZKNJEHWBHLQEP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.01 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|