C12H13NO2 — CID 169028900
2-(6,7-dihydrofuro[2,3-f][1]benzofuran-4-yl)ethanamine (PubChem CID 169028900) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 2-(6,7-dihydrofuro[2,3-f][1]benzofuran-4-yl)ethanamine.
| Compound Name | 2-(6,7-dihydrofuro[2,3-f][1]benzofuran-4-yl)ethanamine |
|---|---|
| PubChem CID | 169028900 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 2-(6,7-dihydrofuro[2,3-f][1]benzofuran-4-yl)ethanamine |
| SMILES | NCCc1c2c(cc3occc13)CCO2 |
| InChI | InChI=1S/C12H13NO2/c13-4-1-10-9-3-6-14-11(9)7-8-2-5-15-12(8)10/h3,6-7H,1-2,4-5,13H2 |
| InChIKey | AKXNXYVBHYPVTH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |