C26H47N4O7P — CID 169029006
(3R,6S,9aS)-1-(2-diethoxyphosphorylacetyl)-8-(1-methylpiperidin-4-yl)-3,6-bis(2-methylpropyl)-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-4,7-dione (PubChem CID 169029006) has the molecular formula C26H47N4O7P and a molecular weight of 558.66 g/mol. Its IUPAC name is (3R,6S,9aS)-1-(2-diethoxyphosphorylacetyl)-8-(1-methylpiperidin-4-yl)-3,6-bis(2-methylpropyl)-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-4,7-dione.
| Compound Name | (3R,6S,9aS)-1-(2-diethoxyphosphorylacetyl)-8-(1-methylpiperidin-4-yl)-3,6-bis(2-methylpropyl)-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-4,7-dione |
|---|---|
| PubChem CID | 169029006 |
| Molecular Formula | C26H47N4O7P |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | (3R,6S,9aS)-1-(2-diethoxyphosphorylacetyl)-8-(1-methylpiperidin-4-yl)-3,6-bis(2-methylpropyl)-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-4,7-dione |
| SMILES | CCOP(=O)(CC(=O)N1O[C@H](CC(C)C)C(=O)N2[C@@H]1CN(C1CCN(C)CC1)C(=O)[C@@H]2CC(C)C)OCC |
| InChI | InChI=1S/C26H47N4O7P/c1-8-35-38(34,36-9-2)17-24(31)30-23-16-28(20-10-12-27(7)13-11-20)25(32)21(14-18(3)4)29(23)26(33)22(37-30)15-19(5)6/h18-23H,8-17H2,1-7H3/t21-,22+,23-/m0/s1 |
| InChIKey | KEDTYNYSAJPPQP-ZRBLBEILSA-N |
| XLogP | 2.95 |
| TPSA | 108.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|