C45H42FN7O3 — CID 169029122
ethyl (1R,5S,6S,7S)-7-[[2-(5-fluoro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)-7-(methoxymethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]tricyclo[3.2.2.02,4]nonane-6-carboxylate (PubChem CID 169029122) has the molecular formula C45H42FN7O3 and a molecular weight of 747.88 g/mol. Its IUPAC name is ethyl (1R,5S,6S,7S)-7-[[2-(5-fluoro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)-7-(methoxymethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]tricyclo[3.2.2.02,4]nonane-6-carboxylate.
| Compound Name | ethyl (1R,5S,6S,7S)-7-[[2-(5-fluoro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)-7-(methoxymethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]tricyclo[3.2.2.02,4]nonane-6-carboxylate |
|---|---|
| PubChem CID | 169029122 |
| Molecular Formula | C45H42FN7O3 |
| Molecular Weight | 747.88 g/mol |
| Exact Mass | 747.33 |
| IUPAC Name | ethyl (1R,5S,6S,7S)-7-[[2-(5-fluoro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)-7-(methoxymethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]tricyclo[3.2.2.02,4]nonane-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](Nc2nc(-c3nn(C(c4ccccc4)(c4ccccc4)c4ccccc4)c4ncc(F)cc34)nn3c(COC)ccc23)[C@@H]2CC[C@H]1C1CC12 |
| InChI | InChI=1S/C45H42FN7O3/c1-3-56-44(54)38-32-20-21-33(35-24-34(32)35)39(38)48-41-37-22-19-31(26-55-2)52(37)51-42(49-41)40-36-23-30(46)25-47-43(36)53(50-40)45(27-13-7-4-8-14-27,28-15-9-5-10-16-28)29-17-11-6-12-18-29/h4-19,22-23,25,32-35,38-39H,3,20-21,24,26H2,1-2H3,(H,48,49,51)/t32-,33+,34?,35?,38-,39-/m0/s1 |
| InChIKey | CBHAFLKLMUPLDQ-RCWQJKGXSA-N |
| XLogP | 7.90 |
| TPSA | 108.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.88 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|