C65H55NO — CID 169029851
N-[4-[4-(6,6,9,9,11,11-hexamethyl-7,8-dihydrobenzo[b]fluoren-3-yl)phenyl]phenyl]-N-[3-(4-phenylphenyl)phenyl]dibenzofuran-3-amine (PubChem CID 169029851) has the molecular formula C65H55NO and a molecular weight of 866.16 g/mol. Its IUPAC name is N-[4-[4-(6,6,9,9,11,11-hexamethyl-7,8-dihydrobenzo[b]fluoren-3-yl)phenyl]phenyl]-N-[3-(4-phenylphenyl)phenyl]dibenzofuran-3-amine.
| Compound Name | N-[4-[4-(6,6,9,9,11,11-hexamethyl-7,8-dihydrobenzo[b]fluoren-3-yl)phenyl]phenyl]-N-[3-(4-phenylphenyl)phenyl]dibenzofuran-3-amine |
|---|---|
| PubChem CID | 169029851 |
| Molecular Formula | C65H55NO |
| Molecular Weight | 866.16 g/mol |
| Exact Mass | 865.43 |
| IUPAC Name | N-[4-[4-(6,6,9,9,11,11-hexamethyl-7,8-dihydrobenzo[b]fluoren-3-yl)phenyl]phenyl]-N-[3-(4-phenylphenyl)phenyl]dibenzofuran-3-amine |
| SMILES | CC1(C)CCC(C)(C)c2cc3c(cc21)-c1cc(-c2ccc(-c4ccc(N(c5cccc(-c6ccc(-c7ccccc7)cc6)c5)c5ccc6c(c5)oc5ccccc56)cc4)cc2)ccc1C3(C)C |
| InChI | InChI=1S/C65H55NO/c1-63(2)35-36-64(3,4)60-41-58-56(40-59(60)63)55-38-49(29-34-57(55)65(58,5)6)47-25-21-44(22-26-47)45-27-30-50(31-28-45)66(52-32-33-54-53-17-10-11-18-61(53)67-62(54)39-52)51-16-12-15-48(37-51)46-23-19-43(20-24-46)42-13-8-7-9-14-42/h7-34,37-41H,35-36H2,1-6H3 |
| InChIKey | XUYYGLKJGIIKGV-UHFFFAOYSA-N |
| XLogP | 18.38 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.16 |
| LogP ≤ 5 | 18.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |