About 4-(4-butylphenyl)butyl 8-bromooctanoate
4-(4-butylphenyl)butyl 8-bromooctanoate (PubChem CID 169030187) has the molecular formula C22H35BrO2
and a molecular weight of 411.42 g/mol. Its IUPAC name is 4-(4-butylphenyl)butyl 8-bromooctanoate.
Molecular Properties
| Compound Name | 4-(4-butylphenyl)butyl 8-bromooctanoate |
| PubChem CID | 169030187 |
| Molecular Formula | C22H35BrO2 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 4-(4-butylphenyl)butyl 8-bromooctanoate |
| SMILES | CCCCc1ccc(CCCCOC(=O)CCCCCCCBr)cc1 |
| InChI | InChI=1S/C22H35BrO2/c1-2-3-11-20-14-16-21(17-15-20)12-8-10-19-25-22(24)13-7-5-4-6-9-18-23/h14-17H,2-13,18-19H2,1H3 |
| InChIKey | WCOBDUWYVYNCMQ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-butylphenyl)butyl 8-bromooctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-butylphenyl)butyl 8-bromooctanoate?
The IUPAC name of 4-(4-butylphenyl)butyl 8-bromooctanoate (CID 169030187) is 4-(4-butylphenyl)butyl 8-bromooctanoate.
What is the SMILES notation for 4-(4-butylphenyl)butyl 8-bromooctanoate?
The canonical SMILES for 4-(4-butylphenyl)butyl 8-bromooctanoate is CCCCc1ccc(CCCCOC(=O)CCCCCCCBr)cc1.
What is the InChIKey of 4-(4-butylphenyl)butyl 8-bromooctanoate?
The InChIKey is WCOBDUWYVYNCMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H35BrO2/c1-2-3-11-20-14-16-21(17-15-20)12-8-10-19-25-22(24)13-7-5-4-6-9-18-23/h14-17H,2-13,18-19H2,1H3.
What are the key properties of 4-(4-butylphenyl)butyl 8-bromooctanoate?
4-(4-butylphenyl)butyl 8-bromooctanoate has a molecular weight of 411.42 g/mol, XLogP of 6.63, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-butylphenyl)butyl 8-bromooctanoate is sourced from PubChem (CID 169030187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).