C50H45BGeO2 — CID 169031111
[4-(4,18-ditert-butyl-8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-11-yl)phenyl]-triphenylgermane (PubChem CID 169031111) has the molecular formula C50H45BGeO2 and a molecular weight of 761.33 g/mol. Its IUPAC name is [4-(4,18-ditert-butyl-8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-11-yl)phenyl]-triphenylgermane.
| Compound Name | [4-(4,18-ditert-butyl-8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-11-yl)phenyl]-triphenylgermane |
|---|---|
| PubChem CID | 169031111 |
| Molecular Formula | C50H45BGeO2 |
| Molecular Weight | 761.33 g/mol |
| Exact Mass | 762.27 |
| IUPAC Name | [4-(4,18-ditert-butyl-8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-11-yl)phenyl]-triphenylgermane |
| SMILES | CC(C)(C)c1ccc2c(c1)B1c3cc(C(C)(C)C)ccc3Oc3cc(-c4ccc([Ge](c5ccccc5)(c5ccccc5)c5ccccc5)cc4)cc(c31)O2 |
| InChI | InChI=1S/C50H45BGeO2/c1-49(2,3)36-24-28-44-42(32-36)51-43-33-37(50(4,5)6)25-29-45(43)54-47-31-35(30-46(53-44)48(47)51)34-22-26-41(27-23-34)52(38-16-10-7-11-17-38,39-18-12-8-13-19-39)40-20-14-9-15-21-40/h7-33H,1-6H3 |
| InChIKey | SYENVOBDDVZRFC-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.33 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|