C51H47N5OSi — CID 169031493
[2-[2-[3-[3-(3-tert-butylphenyl)-2H-benzimidazol-1-yl]phenoxy]-5-phenylindolo[3,2-b]indol-10-yl]-4-pyridinyl]-trimethylsilane (PubChem CID 169031493) has the molecular formula C51H47N5OSi and a molecular weight of 774.06 g/mol. Its IUPAC name is [2-[2-[3-[3-(3-tert-butylphenyl)-2H-benzimidazol-1-yl]phenoxy]-5-phenylindolo[3,2-b]indol-10-yl]-4-pyridinyl]-trimethylsilane.
| Compound Name | [2-[2-[3-[3-(3-tert-butylphenyl)-2H-benzimidazol-1-yl]phenoxy]-5-phenylindolo[3,2-b]indol-10-yl]-4-pyridinyl]-trimethylsilane |
|---|---|
| PubChem CID | 169031493 |
| Molecular Formula | C51H47N5OSi |
| Molecular Weight | 774.06 g/mol |
| Exact Mass | 773.35 |
| IUPAC Name | [2-[2-[3-[3-(3-tert-butylphenyl)-2H-benzimidazol-1-yl]phenoxy]-5-phenylindolo[3,2-b]indol-10-yl]-4-pyridinyl]-trimethylsilane |
| SMILES | CC(C)(C)c1cccc(N2CN(c3cccc(Oc4ccc5c(c4)n(-c4cc([Si](C)(C)C)ccn4)c4c6ccccc6n(-c6ccccc6)c54)c3)c3ccccc32)c1 |
| InChI | InChI=1S/C51H47N5OSi/c1-51(2,3)35-16-14-19-37(30-35)53-34-54(46-25-13-12-24-45(46)53)38-20-15-21-39(31-38)57-40-26-27-43-47(32-40)56(48-33-41(28-29-52-48)58(4,5)6)50-42-22-10-11-23-44(42)55(49(43)50)36-17-8-7-9-18-36/h7-33H,34H2,1-6H3 |
| InChIKey | QNCLGKKKTPQTGT-UHFFFAOYSA-N |
| XLogP | 13.00 |
| TPSA | 38.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.06 |
| LogP ≤ 5 | 13.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|