C16H18N4O5S — CID 169032063
N-(3-cyanooxetan-3-yl)-1,3-diethyl-2,4-dioxoquinazoline-6-sulfonamide (PubChem CID 169032063) has the molecular formula C16H18N4O5S and a molecular weight of 378.41 g/mol. Its IUPAC name is N-(3-cyanooxetan-3-yl)-1,3-diethyl-2,4-dioxoquinazoline-6-sulfonamide.
| Compound Name | N-(3-cyanooxetan-3-yl)-1,3-diethyl-2,4-dioxoquinazoline-6-sulfonamide |
|---|---|
| PubChem CID | 169032063 |
| Molecular Formula | C16H18N4O5S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | N-(3-cyanooxetan-3-yl)-1,3-diethyl-2,4-dioxoquinazoline-6-sulfonamide |
| SMILES | CCn1c(=O)c2cc(S(=O)(=O)NC3(C#N)COC3)ccc2n(CC)c1=O |
| InChI | InChI=1S/C16H18N4O5S/c1-3-19-13-6-5-11(7-12(13)14(21)20(4-2)15(19)22)26(23,24)18-16(8-17)9-25-10-16/h5-7,18H,3-4,9-10H2,1-2H3 |
| InChIKey | WWVNLNJWHCIOHI-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |