C21H24F2N6O4 — CID 169033332
tert-butyl (1R,4R)-5-[6-[[2-(difluoromethyl)-4-pyridinyl]amino]-5-nitro-2-pyridinyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 169033332) has the molecular formula C21H24F2N6O4 and a molecular weight of 462.46 g/mol. Its IUPAC name is tert-butyl (1R,4R)-5-[6-[[2-(difluoromethyl)-4-pyridinyl]amino]-5-nitro-2-pyridinyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl (1R,4R)-5-[6-[[2-(difluoromethyl)-4-pyridinyl]amino]-5-nitro-2-pyridinyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 169033332 |
| Molecular Formula | C21H24F2N6O4 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | tert-butyl (1R,4R)-5-[6-[[2-(difluoromethyl)-4-pyridinyl]amino]-5-nitro-2-pyridinyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@@H]1CN2c1ccc([N+](=O)[O-])c(Nc2ccnc(C(F)F)c2)n1 |
| InChI | InChI=1S/C21H24F2N6O4/c1-21(2,3)33-20(30)28-11-13-9-14(28)10-27(13)17-5-4-16(29(31)32)19(26-17)25-12-6-7-24-15(8-12)18(22)23/h4-8,13-14,18H,9-11H2,1-3H3,(H,24,25,26)/t13-,14-/m1/s1 |
| InChIKey | LWVBUZPRQDUURR-ZIAGYGMSSA-N |
| XLogP | 4.26 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|