C20H23F3N6O4 — CID 169033563
tert-butyl 4-[5-nitro-6-(pyridin-4-ylamino)-2-pyridinyl]-2-(trifluoromethyl)piperazine-1-carboxylate (PubChem CID 169033563) has the molecular formula C20H23F3N6O4 and a molecular weight of 468.44 g/mol. Its IUPAC name is tert-butyl 4-[5-nitro-6-(pyridin-4-ylamino)-2-pyridinyl]-2-(trifluoromethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-nitro-6-(pyridin-4-ylamino)-2-pyridinyl]-2-(trifluoromethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 169033563 |
| Molecular Formula | C20H23F3N6O4 |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | tert-butyl 4-[5-nitro-6-(pyridin-4-ylamino)-2-pyridinyl]-2-(trifluoromethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc([N+](=O)[O-])c(Nc3ccncc3)n2)CC1C(F)(F)F |
| InChI | InChI=1S/C20H23F3N6O4/c1-19(2,3)33-18(30)28-11-10-27(12-15(28)20(21,22)23)16-5-4-14(29(31)32)17(26-16)25-13-6-8-24-9-7-13/h4-9,15H,10-12H2,1-3H3,(H,24,25,26) |
| InChIKey | XWGBTBMXMAQNNB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|