C33H39IrN2O3- — CID 169033660
8-[4-(1-deuteriocyclopentyl)-2-pyridinyl]-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide;(Z)-6-hydroxy-2,8-dimethylnon-5-en-4-one;iridium (PubChem CID 169033660) has the molecular formula C33H39IrN2O3- and a molecular weight of 707.93 g/mol. Its IUPAC name is 8-[4-(1-deuteriocyclopentyl)-2-pyridinyl]-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide;(Z)-6-hydroxy-2,8-dimethylnon-5-en-4-one;iridium.
| Compound Name | 8-[4-(1-deuteriocyclopentyl)-2-pyridinyl]-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide;(Z)-6-hydroxy-2,8-dimethylnon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 169033660 |
| Molecular Formula | C33H39IrN2O3- |
| Molecular Weight | 707.93 g/mol |
| Exact Mass | 708.28 |
| IUPAC Name | 8-[4-(1-deuteriocyclopentyl)-2-pyridinyl]-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide;(Z)-6-hydroxy-2,8-dimethylnon-5-en-4-one;iridium |
| SMILES | CC(C)CC(=O)/C=C(\O)CC(C)C.[2H]C([2H])([2H])c1ccc2c(n1)oc1c(-c3cc(C4([2H])CCCC4)ccn3)[c-]ccc12.[Ir] |
| InChI | InChI=1S/C22H19N2O.C11H20O2.Ir/c1-14-9-10-18-17-7-4-8-19(21(17)25-22(18)24-14)20-13-16(11-12-23-20)15-5-2-3-6-15;1-8(2)5-10(12)7-11(13)6-9(3)4;/h4,7,9-13,15H,2-3,5-6H2,1H3;7-9,12H,5-6H2,1-4H3;/q-1;;/b;10-7-;/i1D3,15D;; |
| InChIKey | FNGDCGNNQYAUHR-JMQWVULQSA-N |
| XLogP | 8.90 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.93 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|