About CID 169033837
CID 169033837 (PubChem CID 169033837) has the molecular formula C59H41FN4O2
and a molecular weight of 857.00 g/mol.
Molecular Properties
| Compound Name | CID 169033837 |
| PubChem CID | 169033837 |
| Molecular Formula | C59H41FN4O2 |
| Molecular Weight | 857.00 g/mol |
| Exact Mass | 856.32 |
| IUPAC Name | — |
| SMILES | Cc1cc2oc3c(-n4[c-][n+]5c6c(cccc64)-c4ccccc4-c4ccccc4-c4ccccc4-5)cc(Oc4ccc5c6ccccc6n(-c6cc(C(C)(C)C)ccn6)c5c4)cc3c2cc1F |
| InChI | InChI=1S/C59H41FN4O2/c1-35-28-55-47(33-49(35)60)48-30-38(65-37-24-25-45-44-19-10-12-22-51(44)64(53(45)31-37)56-29-36(26-27-61-56)59(2,3)4)32-54(58(48)66-55)62-34-63-50-21-11-9-18-43(50)41-16-7-5-14-39(41)40-15-6-8-17-42(40)46-20-13-23-52(62)57(46)63/h5-33H,1-4H3 |
| InChIKey | HHZUQLFZMZMQTE-UHFFFAOYSA-N |
| XLogP | 14.95 |
| TPSA | 49.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 66 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 857.00 |
| LogP ≤ 5 | 14.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 169033837 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169033837?
The IUPAC name of CID 169033837 (CID 169033837) is not available.
What is the SMILES notation for CID 169033837?
The canonical SMILES for CID 169033837 is Cc1cc2oc3c(-n4[c-][n+]5c6c(cccc64)-c4ccccc4-c4ccccc4-c4ccccc4-5)cc(Oc4ccc5c6ccccc6n(-c6cc(C(C)(C)C)ccn6)c5c4)cc3c2cc1F.
What is the InChIKey of CID 169033837?
The InChIKey is HHZUQLFZMZMQTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C59H41FN4O2/c1-35-28-55-47(33-49(35)60)48-30-38(65-37-24-25-45-44-19-10-12-22-51(44)64(53(45)31-37)56-29-36(26-27-61-56)59(2,3)4)32-54(58(48)66-55)62-34-63-50-21-11-9-18-43(50)41-16-7-5-14-39(41)40-15-6-8-17-42(40)46-20-13-23-52(62)57(46)63/h5-33H,1-4H3.
What are the key properties of CID 169033837?
CID 169033837 has a molecular weight of 857.00 g/mol, XLogP of 14.95, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169033837 is sourced from PubChem (CID 169033837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).