C44H61NO5 — CID 169033929
(Z)-1-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]octadec-9-en-1-one (PubChem CID 169033929) has the molecular formula C44H61NO5 and a molecular weight of 683.97 g/mol. Its IUPAC name is (Z)-1-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]octadec-9-en-1-one.
| Compound Name | (Z)-1-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]octadec-9-en-1-one |
|---|---|
| PubChem CID | 169033929 |
| Molecular Formula | C44H61NO5 |
| Molecular Weight | 683.97 g/mol |
| Exact Mass | 683.45 |
| IUPAC Name | (Z)-1-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]octadec-9-en-1-one |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N1C[C@H](O)C[C@H]1COC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C44H61NO5/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-24-43(47)45-34-40(46)33-39(45)35-50-44(36-22-19-18-20-23-36,37-25-29-41(48-2)30-26-37)38-27-31-42(49-3)32-28-38/h11-12,18-20,22-23,25-32,39-40,46H,4-10,13-17,21,24,33-35H2,1-3H3/b12-11-/t39-,40+/m0/s1 |
| InChIKey | XTFNFMXGQNUBSS-RMFMOICSSA-N |
| XLogP | 10.01 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.97 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|