About 6-(5-fluoro-3-methyl-2,4-dioxopyrimidin-1-yl)hexyl 2-methylpropanoate
6-(5-fluoro-3-methyl-2,4-dioxopyrimidin-1-yl)hexyl 2-methylpropanoate (PubChem CID 169034321) has the molecular formula C15H23FN2O4
and a molecular weight of 314.36 g/mol. Its IUPAC name is 6-(5-fluoro-3-methyl-2,4-dioxopyrimidin-1-yl)hexyl 2-methylpropanoate.
Molecular Properties
| Compound Name | 6-(5-fluoro-3-methyl-2,4-dioxopyrimidin-1-yl)hexyl 2-methylpropanoate |
| PubChem CID | 169034321 |
| Molecular Formula | C15H23FN2O4 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 6-(5-fluoro-3-methyl-2,4-dioxopyrimidin-1-yl)hexyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCCCCCCn1cc(F)c(=O)n(C)c1=O |
| InChI | InChI=1S/C15H23FN2O4/c1-11(2)14(20)22-9-7-5-4-6-8-18-10-12(16)13(19)17(3)15(18)21/h10-11H,4-9H2,1-3H3 |
| InChIKey | IQQQZKNPKWOHQS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(5-fluoro-3-methyl-2,4-dioxopyrimidin-1-yl)hexyl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5-fluoro-3-methyl-2,4-dioxopyrimidin-1-yl)hexyl 2-methylpropanoate?
The IUPAC name of 6-(5-fluoro-3-methyl-2,4-dioxopyrimidin-1-yl)hexyl 2-methylpropanoate (CID 169034321) is 6-(5-fluoro-3-methyl-2,4-dioxopyrimidin-1-yl)hexyl 2-methylpropanoate.
What is the SMILES notation for 6-(5-fluoro-3-methyl-2,4-dioxopyrimidin-1-yl)hexyl 2-methylpropanoate?
The canonical SMILES for 6-(5-fluoro-3-methyl-2,4-dioxopyrimidin-1-yl)hexyl 2-methylpropanoate is CC(C)C(=O)OCCCCCCn1cc(F)c(=O)n(C)c1=O.
What is the InChIKey of 6-(5-fluoro-3-methyl-2,4-dioxopyrimidin-1-yl)hexyl 2-methylpropanoate?
The InChIKey is IQQQZKNPKWOHQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23FN2O4/c1-11(2)14(20)22-9-7-5-4-6-8-18-10-12(16)13(19)17(3)15(18)21/h10-11H,4-9H2,1-3H3.
What are the key properties of 6-(5-fluoro-3-methyl-2,4-dioxopyrimidin-1-yl)hexyl 2-methylpropanoate?
6-(5-fluoro-3-methyl-2,4-dioxopyrimidin-1-yl)hexyl 2-methylpropanoate has a molecular weight of 314.36 g/mol, XLogP of 1.45, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5-fluoro-3-methyl-2,4-dioxopyrimidin-1-yl)hexyl 2-methylpropanoate is sourced from PubChem (CID 169034321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).