About 3-(2,4-dioxopyrimidin-1-yl)propyl propanoate
3-(2,4-dioxopyrimidin-1-yl)propyl propanoate (PubChem CID 169034415) has the molecular formula C10H14N2O4
and a molecular weight of 226.23 g/mol. Its IUPAC name is 3-(2,4-dioxopyrimidin-1-yl)propyl propanoate.
Molecular Properties
| Compound Name | 3-(2,4-dioxopyrimidin-1-yl)propyl propanoate |
| PubChem CID | 169034415 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 3-(2,4-dioxopyrimidin-1-yl)propyl propanoate |
| SMILES | CCC(=O)OCCCn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H14N2O4/c1-2-9(14)16-7-3-5-12-6-4-8(13)11-10(12)15/h4,6H,2-3,5,7H2,1H3,(H,11,13,15) |
| InChIKey | QONGOASJCWWLSB-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,4-dioxopyrimidin-1-yl)propyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dioxopyrimidin-1-yl)propyl propanoate?
The IUPAC name of 3-(2,4-dioxopyrimidin-1-yl)propyl propanoate (CID 169034415) is 3-(2,4-dioxopyrimidin-1-yl)propyl propanoate.
What is the SMILES notation for 3-(2,4-dioxopyrimidin-1-yl)propyl propanoate?
The canonical SMILES for 3-(2,4-dioxopyrimidin-1-yl)propyl propanoate is CCC(=O)OCCCn1ccc(=O)[nH]c1=O.
What is the InChIKey of 3-(2,4-dioxopyrimidin-1-yl)propyl propanoate?
The InChIKey is QONGOASJCWWLSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O4/c1-2-9(14)16-7-3-5-12-6-4-8(13)11-10(12)15/h4,6H,2-3,5,7H2,1H3,(H,11,13,15).
What are the key properties of 3-(2,4-dioxopyrimidin-1-yl)propyl propanoate?
3-(2,4-dioxopyrimidin-1-yl)propyl propanoate has a molecular weight of 226.23 g/mol, XLogP of -0.12, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dioxopyrimidin-1-yl)propyl propanoate is sourced from PubChem (CID 169034415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).