About [6-(5-methyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-oxohexyl] 2-methylprop-2-enoate
[6-(5-methyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-oxohexyl] 2-methylprop-2-enoate (PubChem CID 169034482) has the molecular formula C15H20N2O5
and a molecular weight of 308.33 g/mol. Its IUPAC name is [6-(5-methyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-oxohexyl] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [6-(5-methyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-oxohexyl] 2-methylprop-2-enoate |
| PubChem CID | 169034482 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | [6-(5-methyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-oxohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCC(=O)n1c(=O)[nH]cc(C)c1=O |
| InChI | InChI=1S/C15H20N2O5/c1-10(2)14(20)22-8-6-4-5-7-12(18)17-13(19)11(3)9-16-15(17)21/h9H,1,4-8H2,2-3H3,(H,16,21) |
| InChIKey | FUVYVGKBJOPYFR-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [6-(5-methyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-oxohexyl] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(5-methyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-oxohexyl] 2-methylprop-2-enoate?
The IUPAC name of [6-(5-methyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-oxohexyl] 2-methylprop-2-enoate (CID 169034482) is [6-(5-methyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-oxohexyl] 2-methylprop-2-enoate.
What is the SMILES notation for [6-(5-methyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-oxohexyl] 2-methylprop-2-enoate?
The canonical SMILES for [6-(5-methyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-oxohexyl] 2-methylprop-2-enoate is C=C(C)C(=O)OCCCCCC(=O)n1c(=O)[nH]cc(C)c1=O.
What is the InChIKey of [6-(5-methyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-oxohexyl] 2-methylprop-2-enoate?
The InChIKey is FUVYVGKBJOPYFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O5/c1-10(2)14(20)22-8-6-4-5-7-12(18)17-13(19)11(3)9-16-15(17)21/h9H,1,4-8H2,2-3H3,(H,16,21).
What are the key properties of [6-(5-methyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-oxohexyl] 2-methylprop-2-enoate?
[6-(5-methyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-oxohexyl] 2-methylprop-2-enoate has a molecular weight of 308.33 g/mol, XLogP of 1.16, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(5-methyl-2,4-dioxo-1H-pyrimidin-3-yl)-6-oxohexyl] 2-methylprop-2-enoate is sourced from PubChem (CID 169034482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).