About [6-(5-fluoro-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2-methylpropanoate
[6-(5-fluoro-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2-methylpropanoate (PubChem CID 169034542) has the molecular formula C14H19FN2O5
and a molecular weight of 314.31 g/mol. Its IUPAC name is [6-(5-fluoro-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2-methylpropanoate.
Molecular Properties
| Compound Name | [6-(5-fluoro-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2-methylpropanoate |
| PubChem CID | 169034542 |
| Molecular Formula | C14H19FN2O5 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | [6-(5-fluoro-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCCCCCC(=O)n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H19FN2O5/c1-9(2)13(20)22-7-5-3-4-6-11(18)17-8-10(15)12(19)16-14(17)21/h8-9H,3-7H2,1-2H3,(H,16,19,21) |
| InChIKey | ZJZLNVXWHPNVHS-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [6-(5-fluoro-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(5-fluoro-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2-methylpropanoate?
The IUPAC name of [6-(5-fluoro-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2-methylpropanoate (CID 169034542) is [6-(5-fluoro-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2-methylpropanoate.
What is the SMILES notation for [6-(5-fluoro-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2-methylpropanoate?
The canonical SMILES for [6-(5-fluoro-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2-methylpropanoate is CC(C)C(=O)OCCCCCC(=O)n1cc(F)c(=O)[nH]c1=O.
What is the InChIKey of [6-(5-fluoro-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2-methylpropanoate?
The InChIKey is ZJZLNVXWHPNVHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19FN2O5/c1-9(2)13(20)22-7-5-3-4-6-11(18)17-8-10(15)12(19)16-14(17)21/h8-9H,3-7H2,1-2H3,(H,16,19,21).
What are the key properties of [6-(5-fluoro-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2-methylpropanoate?
[6-(5-fluoro-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2-methylpropanoate has a molecular weight of 314.31 g/mol, XLogP of 1.08, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(5-fluoro-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2-methylpropanoate is sourced from PubChem (CID 169034542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).