C31H50O3 — CID 169034880
[10,13-dimethyl-17-(4-methylpentan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-methyl-3-oxopentanoate (PubChem CID 169034880) has the molecular formula C31H50O3 and a molecular weight of 470.74 g/mol. Its IUPAC name is [10,13-dimethyl-17-(4-methylpentan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-methyl-3-oxopentanoate.
| Compound Name | [10,13-dimethyl-17-(4-methylpentan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-methyl-3-oxopentanoate |
|---|---|
| PubChem CID | 169034880 |
| Molecular Formula | C31H50O3 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.38 |
| IUPAC Name | [10,13-dimethyl-17-(4-methylpentan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-methyl-3-oxopentanoate |
| SMILES | CC(C)CC(C)C1CCC2C3CC=C4CC(OC(=O)CC(=O)C(C)C)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C31H50O3/c1-19(2)16-21(5)25-10-11-26-24-9-8-22-17-23(34-29(33)18-28(32)20(3)4)12-14-30(22,6)27(24)13-15-31(25,26)7/h8,19-21,23-27H,9-18H2,1-7H3 |
| InChIKey | SYYNNCNPRPNDFI-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|