C13H16O8 — CID 169035096
methyl (3aR,7aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxo-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-carboxylate (PubChem CID 169035096) has the molecular formula C13H16O8 and a molecular weight of 300.26 g/mol. Its IUPAC name is methyl (3aR,7aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxo-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-carboxylate.
| Compound Name | methyl (3aR,7aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxo-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-carboxylate |
|---|---|
| PubChem CID | 169035096 |
| Molecular Formula | C13H16O8 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | methyl (3aR,7aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxo-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-carboxylate |
| SMILES | COC(=O)C1=C[C@H]2OC(=O)O[C@H]2C([C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C13H16O8/c1-13(2)17-5-8(21-13)10-9-6(19-12(15)20-9)4-7(18-10)11(14)16-3/h4,6,8-10H,5H2,1-3H3/t6-,8-,9-,10?/m1/s1 |
| InChIKey | BXKKIZFUJYDGAM-XIWVQZPPSA-N |
| XLogP | 0.50 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |