C47H28O — CID 169035189
7,7-diphenyl-3-(4,5,9,10-tetradeuteriopyren-1-yl)fluoreno[4,3-b][1]benzofuran (PubChem CID 169035189) has the molecular formula C47H28O and a molecular weight of 612.76 g/mol. Its IUPAC name is 7,7-diphenyl-3-(4,5,9,10-tetradeuteriopyren-1-yl)fluoreno[4,3-b][1]benzofuran.
| Compound Name | 7,7-diphenyl-3-(4,5,9,10-tetradeuteriopyren-1-yl)fluoreno[4,3-b][1]benzofuran |
|---|---|
| PubChem CID | 169035189 |
| Molecular Formula | C47H28O |
| Molecular Weight | 612.76 g/mol |
| Exact Mass | 612.24 |
| IUPAC Name | 7,7-diphenyl-3-(4,5,9,10-tetradeuteriopyren-1-yl)fluoreno[4,3-b][1]benzofuran |
| SMILES | [2H]c1c([2H])c2ccc(-c3ccc4oc5c6c(ccc5c4c3)C(c3ccccc3)(c3ccccc3)c3ccccc3-6)c3c([2H])c([2H])c4cccc1c4c23 |
| InChI | InChI=1S/C47H28O/c1-3-12-33(13-4-1)47(34-14-5-2-6-15-34)40-17-8-7-16-38(40)45-41(47)26-25-37-39-28-32(22-27-42(39)48-46(37)45)35-23-20-31-19-18-29-10-9-11-30-21-24-36(35)44(31)43(29)30/h1-28H/i18D,19D,21D,24D |
| InChIKey | XDOJQVMWWQZRMG-UEBMTVLISA-N |
| XLogP | 12.51 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.76 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|