About 3,3-dimethylbutyl 5,5-dimethylhexyl hydrogen phosphate
3,3-dimethylbutyl 5,5-dimethylhexyl hydrogen phosphate (PubChem CID 169035399) has the molecular formula C14H31O4P
and a molecular weight of 294.37 g/mol. Its IUPAC name is 3,3-dimethylbutyl 5,5-dimethylhexyl hydrogen phosphate.
Molecular Properties
| Compound Name | 3,3-dimethylbutyl 5,5-dimethylhexyl hydrogen phosphate |
| PubChem CID | 169035399 |
| Molecular Formula | C14H31O4P |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 3,3-dimethylbutyl 5,5-dimethylhexyl hydrogen phosphate |
| SMILES | CC(C)(C)CCCCOP(=O)(O)OCCC(C)(C)C |
| InChI | InChI=1S/C14H31O4P/c1-13(2,3)9-7-8-11-17-19(15,16)18-12-10-14(4,5)6/h7-12H2,1-6H3,(H,15,16) |
| InChIKey | LABGFONNKVWRGK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethylbutyl 5,5-dimethylhexyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylbutyl 5,5-dimethylhexyl hydrogen phosphate?
The IUPAC name of 3,3-dimethylbutyl 5,5-dimethylhexyl hydrogen phosphate (CID 169035399) is 3,3-dimethylbutyl 5,5-dimethylhexyl hydrogen phosphate.
What is the SMILES notation for 3,3-dimethylbutyl 5,5-dimethylhexyl hydrogen phosphate?
The canonical SMILES for 3,3-dimethylbutyl 5,5-dimethylhexyl hydrogen phosphate is CC(C)(C)CCCCOP(=O)(O)OCCC(C)(C)C.
What is the InChIKey of 3,3-dimethylbutyl 5,5-dimethylhexyl hydrogen phosphate?
The InChIKey is LABGFONNKVWRGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31O4P/c1-13(2,3)9-7-8-11-17-19(15,16)18-12-10-14(4,5)6/h7-12H2,1-6H3,(H,15,16).
What are the key properties of 3,3-dimethylbutyl 5,5-dimethylhexyl hydrogen phosphate?
3,3-dimethylbutyl 5,5-dimethylhexyl hydrogen phosphate has a molecular weight of 294.37 g/mol, XLogP of 4.77, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylbutyl 5,5-dimethylhexyl hydrogen phosphate is sourced from PubChem (CID 169035399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).