C60H36N8O — CID 169036896
5-[4-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-12-(4,6-diphenyl-1,3,5-triazin-2-yl)indolo[3,2-c]carbazole (PubChem CID 169036896) has the molecular formula C60H36N8O and a molecular weight of 885.00 g/mol. Its IUPAC name is 5-[4-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-12-(4,6-diphenyl-1,3,5-triazin-2-yl)indolo[3,2-c]carbazole.
| Compound Name | 5-[4-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-12-(4,6-diphenyl-1,3,5-triazin-2-yl)indolo[3,2-c]carbazole |
|---|---|
| PubChem CID | 169036896 |
| Molecular Formula | C60H36N8O |
| Molecular Weight | 885.00 g/mol |
| Exact Mass | 884.30 |
| IUPAC Name | 5-[4-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-12-(4,6-diphenyl-1,3,5-triazin-2-yl)indolo[3,2-c]carbazole |
| SMILES | c1ccc(-c2nc(-c3ccc(-n4c5ccccc5c5c4ccc4c6ccccc6n(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c45)cc3)nc(-c3ccc4c(c3)oc3ccccc34)n2)cc1 |
| InChI | InChI=1S/C60H36N8O/c1-4-16-37(17-5-1)55-61-56(63-59(62-55)41-30-33-45-44-23-12-15-27-51(44)69-52(45)36-41)40-28-31-42(32-29-40)67-49-26-14-11-24-47(49)53-50(67)35-34-46-43-22-10-13-25-48(43)68(54(46)53)60-65-57(38-18-6-2-7-19-38)64-58(66-60)39-20-8-3-9-21-39/h1-36H |
| InChIKey | IRWFNXYXPUMGDE-UHFFFAOYSA-N |
| XLogP | 14.49 |
| TPSA | 100.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.00 |
| LogP ≤ 5 | 14.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |