C73H46N8 — CID 169037030
12-[4-(9,9-diphenylfluoren-2-yl)-6-phenyl-1,3,5-triazin-2-yl]-11-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]indolo[2,3-a]carbazole (PubChem CID 169037030) has the molecular formula C73H46N8 and a molecular weight of 1035.23 g/mol. Its IUPAC name is 12-[4-(9,9-diphenylfluoren-2-yl)-6-phenyl-1,3,5-triazin-2-yl]-11-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]indolo[2,3-a]carbazole.
| Compound Name | 12-[4-(9,9-diphenylfluoren-2-yl)-6-phenyl-1,3,5-triazin-2-yl]-11-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]indolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 169037030 |
| Molecular Formula | C73H46N8 |
| Molecular Weight | 1035.23 g/mol |
| Exact Mass | 1034.38 |
| IUPAC Name | 12-[4-(9,9-diphenylfluoren-2-yl)-6-phenyl-1,3,5-triazin-2-yl]-11-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]indolo[2,3-a]carbazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-n4c5ccccc5c5ccc6c7ccccc7n(-c7nc(-c8ccccc8)nc(-c8ccc9c(c8)C(c8ccccc8)(c8ccccc8)c8ccccc8-9)n7)c6c54)c3)n2)cc1 |
| InChI | InChI=1S/C73H46N8/c1-6-23-47(24-7-1)67-74-68(48-25-8-2-9-26-48)76-70(75-67)50-29-22-34-54(45-50)80-63-39-20-17-36-57(63)59-43-44-60-58-37-18-21-40-64(58)81(66(60)65(59)80)72-78-69(49-27-10-3-11-28-49)77-71(79-72)51-41-42-56-55-35-16-19-38-61(55)73(62(56)46-51,52-30-12-4-13-31-52)53-32-14-5-15-33-53/h1-46H |
| InChIKey | DVSCGUOZFNPCHY-UHFFFAOYSA-N |
| XLogP | 16.95 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1035.23 |
| LogP ≤ 5 | 16.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |