C48H44N2 — CID 169037522
6-[9-[(1S)-4-cyclohexa-2,4-dien-1-ylcyclohexa-2,4-dien-1-yl]-1,7,8,9a-tetrahydrocarbazol-3-yl]-9-(4-phenylphenyl)-1,2,6,7-tetrahydrocarbazole (PubChem CID 169037522) has the molecular formula C48H44N2 and a molecular weight of 648.89 g/mol. Its IUPAC name is 6-[9-[(1S)-4-cyclohexa-2,4-dien-1-ylcyclohexa-2,4-dien-1-yl]-1,7,8,9a-tetrahydrocarbazol-3-yl]-9-(4-phenylphenyl)-1,2,6,7-tetrahydrocarbazole.
| Compound Name | 6-[9-[(1S)-4-cyclohexa-2,4-dien-1-ylcyclohexa-2,4-dien-1-yl]-1,7,8,9a-tetrahydrocarbazol-3-yl]-9-(4-phenylphenyl)-1,2,6,7-tetrahydrocarbazole |
|---|---|
| PubChem CID | 169037522 |
| Molecular Formula | C48H44N2 |
| Molecular Weight | 648.89 g/mol |
| Exact Mass | 648.35 |
| IUPAC Name | 6-[9-[(1S)-4-cyclohexa-2,4-dien-1-ylcyclohexa-2,4-dien-1-yl]-1,7,8,9a-tetrahydrocarbazol-3-yl]-9-(4-phenylphenyl)-1,2,6,7-tetrahydrocarbazole |
| SMILES | C1=CCC(C2=CC[C@H](N3C4=C(C=CCC4)C4=CC(C5C=c6c7c(n(-c8ccc(-c9ccccc9)cc8)c6=CC5)CCC=C7)=CCC43)C=C2)C=C1 |
| InChI | InChI=1S/C48H44N2/c1-3-11-33(12-4-1)35-19-25-39(26-20-35)49-45-17-9-7-15-41(45)43-31-37(23-29-47(43)49)38-24-30-48-44(32-38)42-16-8-10-18-46(42)50(48)40-27-21-36(22-28-40)34-13-5-2-6-14-34/h1-8,11-13,15-16,19-22,24-27,29,31-32,34,37,40,48H,9-10,14,17-18,23,28,30H2/t34?,37?,40-,48?/m1/s1 |
| InChIKey | NCKLFPIICOEJAK-ZPTIPHCOSA-N |
| XLogP | 9.62 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.89 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |