C56H48BNO — CID 169038349
11-tert-butyl-5,17-bis(3,5-dimethylphenyl)-14-(2,6-diphenylphenyl)-8-oxa-14-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 169038349) has the molecular formula C56H48BNO and a molecular weight of 761.82 g/mol. Its IUPAC name is 11-tert-butyl-5,17-bis(3,5-dimethylphenyl)-14-(2,6-diphenylphenyl)-8-oxa-14-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 11-tert-butyl-5,17-bis(3,5-dimethylphenyl)-14-(2,6-diphenylphenyl)-8-oxa-14-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 169038349 |
| Molecular Formula | C56H48BNO |
| Molecular Weight | 761.82 g/mol |
| Exact Mass | 761.38 |
| IUPAC Name | 11-tert-butyl-5,17-bis(3,5-dimethylphenyl)-14-(2,6-diphenylphenyl)-8-oxa-14-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | Cc1cc(C)cc(-c2ccc3c(c2)Oc2cc(C(C)(C)C)cc4c2B3c2ccc(-c3cc(C)cc(C)c3)cc2N4c2c(-c3ccccc3)cccc2-c2ccccc2)c1 |
| InChI | InChI=1S/C56H48BNO/c1-35-25-36(2)28-43(27-35)41-21-23-48-50(31-41)58(55-46(39-15-10-8-11-16-39)19-14-20-47(55)40-17-12-9-13-18-40)51-33-45(56(5,6)7)34-53-54(51)57(48)49-24-22-42(32-52(49)59-53)44-29-37(3)26-38(4)30-44/h8-34H,1-7H3 |
| InChIKey | MAFDNKDVBPEWLU-UHFFFAOYSA-N |
| XLogP | 13.29 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.82 |
| LogP ≤ 5 | 13.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|