About 4-but-3-en-2-yloxy-2,6,8-trimethylnonane
4-but-3-en-2-yloxy-2,6,8-trimethylnonane (PubChem CID 169038465) has the molecular formula C16H32O
and a molecular weight of 240.43 g/mol. Its IUPAC name is 4-but-3-en-2-yloxy-2,6,8-trimethylnonane.
Molecular Properties
| Compound Name | 4-but-3-en-2-yloxy-2,6,8-trimethylnonane |
| PubChem CID | 169038465 |
| Molecular Formula | C16H32O |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.25 |
| IUPAC Name | 4-but-3-en-2-yloxy-2,6,8-trimethylnonane |
| SMILES | C=CC(C)OC(CC(C)C)CC(C)CC(C)C |
| InChI | InChI=1S/C16H32O/c1-8-15(7)17-16(10-13(4)5)11-14(6)9-12(2)3/h8,12-16H,1,9-11H2,2-7H3 |
| InChIKey | CVBRGYGOUCNOOT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-but-3-en-2-yloxy-2,6,8-trimethylnonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-3-en-2-yloxy-2,6,8-trimethylnonane?
The IUPAC name of 4-but-3-en-2-yloxy-2,6,8-trimethylnonane (CID 169038465) is 4-but-3-en-2-yloxy-2,6,8-trimethylnonane.
What is the SMILES notation for 4-but-3-en-2-yloxy-2,6,8-trimethylnonane?
The canonical SMILES for 4-but-3-en-2-yloxy-2,6,8-trimethylnonane is C=CC(C)OC(CC(C)C)CC(C)CC(C)C.
What is the InChIKey of 4-but-3-en-2-yloxy-2,6,8-trimethylnonane?
The InChIKey is CVBRGYGOUCNOOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O/c1-8-15(7)17-16(10-13(4)5)11-14(6)9-12(2)3/h8,12-16H,1,9-11H2,2-7H3.
What are the key properties of 4-but-3-en-2-yloxy-2,6,8-trimethylnonane?
4-but-3-en-2-yloxy-2,6,8-trimethylnonane has a molecular weight of 240.43 g/mol, XLogP of 5.06, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-3-en-2-yloxy-2,6,8-trimethylnonane is sourced from PubChem (CID 169038465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).