C35H78O3Si3 — CID 169040245
8-[dimethoxy(methyl)silyl]octyl-[8-[10-ethoxydecyl(dimethyl)silyl]octyl]-dimethylsilane (PubChem CID 169040245) has the molecular formula C35H78O3Si3 and a molecular weight of 631.26 g/mol. Its IUPAC name is 8-[dimethoxy(methyl)silyl]octyl-[8-[10-ethoxydecyl(dimethyl)silyl]octyl]-dimethylsilane.
| Compound Name | 8-[dimethoxy(methyl)silyl]octyl-[8-[10-ethoxydecyl(dimethyl)silyl]octyl]-dimethylsilane |
|---|---|
| PubChem CID | 169040245 |
| Molecular Formula | C35H78O3Si3 |
| Molecular Weight | 631.26 g/mol |
| Exact Mass | 630.53 |
| IUPAC Name | 8-[dimethoxy(methyl)silyl]octyl-[8-[10-ethoxydecyl(dimethyl)silyl]octyl]-dimethylsilane |
| SMILES | CCOCCCCCCCCCC[Si](C)(C)CCCCCCCC[Si](C)(C)CCCCCCCC[Si](C)(OC)OC |
| InChI | InChI=1S/C35H78O3Si3/c1-9-38-30-24-18-12-10-11-13-19-25-31-39(4,5)32-26-20-14-15-21-27-33-40(6,7)34-28-22-16-17-23-29-35-41(8,36-2)37-3/h9-35H2,1-8H3 |
| InChIKey | TWHLTRFFQNQJOS-UHFFFAOYSA-N |
| XLogP | 12.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.26 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|