C18H27ClN6OS — CID 16904028
4-chloro-N-[2-(6-propylsulfanyl-4-pyrrolidin-1-ylpyrazolo[5,4-d]pyrimidin-1-yl)ethyl]butanamide (PubChem CID 16904028) has the molecular formula C18H27ClN6OS and a molecular weight of 410.98 g/mol. Its IUPAC name is 4-chloro-N-[2-(6-propylsulfanyl-4-pyrrolidin-1-ylpyrazolo[5,4-d]pyrimidin-1-yl)ethyl]butanamide.
| Compound Name | 4-chloro-N-[2-(6-propylsulfanyl-4-pyrrolidin-1-ylpyrazolo[5,4-d]pyrimidin-1-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 16904028 |
| Molecular Formula | C18H27ClN6OS |
| Molecular Weight | 410.98 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 4-chloro-N-[2-(6-propylsulfanyl-4-pyrrolidin-1-ylpyrazolo[5,4-d]pyrimidin-1-yl)ethyl]butanamide |
| SMILES | CCCSc1nc(N2CCCC2)c2cnn(CCNC(=O)CCCCl)c2n1 |
| InChI | InChI=1S/C18H27ClN6OS/c1-2-12-27-18-22-16(24-9-3-4-10-24)14-13-21-25(17(14)23-18)11-8-20-15(26)6-5-7-19/h13H,2-12H2,1H3,(H,20,26) |
| InChIKey | IBDNENUABIYOIW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.98 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|