C26H31N11O5 — CID 169041234
(4S)-4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[4-(1-methyltriazol-4-yl)butylamino]-5-oxopentanoic acid (PubChem CID 169041234) has the molecular formula C26H31N11O5 and a molecular weight of 577.61 g/mol. Its IUPAC name is (4S)-4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[4-(1-methyltriazol-4-yl)butylamino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[4-(1-methyltriazol-4-yl)butylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 169041234 |
| Molecular Formula | C26H31N11O5 |
| Molecular Weight | 577.61 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | (4S)-4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[4-(1-methyltriazol-4-yl)butylamino]-5-oxopentanoic acid |
| SMILES | Cn1cc(CCCCNC(=O)[C@H](CCC(=O)O)NC(=O)c2ccc(NCc3cnc4nc(N)[nH]c(=O)c4n3)cc2)nn1 |
| InChI | InChI=1S/C26H31N11O5/c1-37-14-17(35-36-37)4-2-3-11-28-24(41)19(9-10-20(38)39)32-23(40)15-5-7-16(8-6-15)29-12-18-13-30-22-21(31-18)25(42)34-26(27)33-22/h5-8,13-14,19,29H,2-4,9-12H2,1H3,(H,28,41)(H,32,40)(H,38,39)(H3,27,30,33,34,42)/t19-/m0/s1 |
| InChIKey | OJBVVYANIIVYPA-IBGZPJMESA-N |
| XLogP | 0.14 |
| TPSA | 235.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.61 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|