C24H32FNOSi — CID 169041327
tert-butyl-[[(2S,8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-diphenylsilane (PubChem CID 169041327) has the molecular formula C24H32FNOSi and a molecular weight of 397.61 g/mol. Its IUPAC name is tert-butyl-[[(2S,8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2S,8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 169041327 |
| Molecular Formula | C24H32FNOSi |
| Molecular Weight | 397.61 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | tert-butyl-[[(2S,8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@]12CCCN1C[C@@H](F)C2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H32FNOSi/c1-23(2,3)28(21-11-6-4-7-12-21,22-13-8-5-9-14-22)27-19-24-15-10-16-26(24)18-20(25)17-24/h4-9,11-14,20H,10,15-19H2,1-3H3/t20-,24+/m0/s1 |
| InChIKey | XSVOWAFUVRWUKA-GBXCKJPGSA-N |
| XLogP | 4.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.61 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|