About [2-(oxan-4-ylmethyl)-1,2,4-triazol-3-yl]methylazanium
[2-(oxan-4-ylmethyl)-1,2,4-triazol-3-yl]methylazanium (PubChem CID 169041820) has the molecular formula C9H17N4O+
and a molecular weight of 197.26 g/mol. Its IUPAC name is [2-(oxan-4-ylmethyl)-1,2,4-triazol-3-yl]methylazanium.
Molecular Properties
| Compound Name | [2-(oxan-4-ylmethyl)-1,2,4-triazol-3-yl]methylazanium |
| PubChem CID | 169041820 |
| Molecular Formula | C9H17N4O+ |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | [2-(oxan-4-ylmethyl)-1,2,4-triazol-3-yl]methylazanium |
| SMILES | [NH3+]Cc1ncnn1CC1CCOCC1 |
| InChI | InChI=1S/C9H16N4O/c10-5-9-11-7-12-13(9)6-8-1-3-14-4-2-8/h7-8H,1-6,10H2/p+1 |
| InChIKey | RITGQKIMSRLLHM-UHFFFAOYSA-O |
| XLogP | -0.55 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(oxan-4-ylmethyl)-1,2,4-triazol-3-yl]methylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(oxan-4-ylmethyl)-1,2,4-triazol-3-yl]methylazanium?
The IUPAC name of [2-(oxan-4-ylmethyl)-1,2,4-triazol-3-yl]methylazanium (CID 169041820) is [2-(oxan-4-ylmethyl)-1,2,4-triazol-3-yl]methylazanium.
What is the SMILES notation for [2-(oxan-4-ylmethyl)-1,2,4-triazol-3-yl]methylazanium?
The canonical SMILES for [2-(oxan-4-ylmethyl)-1,2,4-triazol-3-yl]methylazanium is [NH3+]Cc1ncnn1CC1CCOCC1.
What is the InChIKey of [2-(oxan-4-ylmethyl)-1,2,4-triazol-3-yl]methylazanium?
The InChIKey is RITGQKIMSRLLHM-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H16N4O/c10-5-9-11-7-12-13(9)6-8-1-3-14-4-2-8/h7-8H,1-6,10H2/p+1.
What are the key properties of [2-(oxan-4-ylmethyl)-1,2,4-triazol-3-yl]methylazanium?
[2-(oxan-4-ylmethyl)-1,2,4-triazol-3-yl]methylazanium has a molecular weight of 197.26 g/mol, XLogP of -0.55, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(oxan-4-ylmethyl)-1,2,4-triazol-3-yl]methylazanium is sourced from PubChem (CID 169041820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).