C15H17ClN2O3 — CID 169042754
(3S,7R,8aS)-3-[(4-chlorophenyl)methyl]-7-methoxy-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 169042754) has the molecular formula C15H17ClN2O3 and a molecular weight of 308.76 g/mol. Its IUPAC name is (3S,7R,8aS)-3-[(4-chlorophenyl)methyl]-7-methoxy-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (3S,7R,8aS)-3-[(4-chlorophenyl)methyl]-7-methoxy-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 169042754 |
| Molecular Formula | C15H17ClN2O3 |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | (3S,7R,8aS)-3-[(4-chlorophenyl)methyl]-7-methoxy-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | CO[C@@H]1C[C@H]2C(=O)N[C@@H](Cc3ccc(Cl)cc3)C(=O)N2C1 |
| InChI | InChI=1S/C15H17ClN2O3/c1-21-11-7-13-14(19)17-12(15(20)18(13)8-11)6-9-2-4-10(16)5-3-9/h2-5,11-13H,6-8H2,1H3,(H,17,19)/t11-,12+,13+/m1/s1 |
| InChIKey | MXKAFFUMMZACKS-AGIUHOORSA-N |
| XLogP | 1.00 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |