C40H27N4Pt-3 — CID 169042836
2-[9-[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]fluoren-9-yl]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum (PubChem CID 169042836) has the molecular formula C40H27N4Pt-3 and a molecular weight of 758.76 g/mol. Its IUPAC name is 2-[9-[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]fluoren-9-yl]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum.
| Compound Name | 2-[9-[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]fluoren-9-yl]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum |
|---|---|
| PubChem CID | 169042836 |
| Molecular Formula | C40H27N4Pt-3 |
| Molecular Weight | 758.76 g/mol |
| Exact Mass | 758.19 |
| IUPAC Name | 2-[9-[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]fluoren-9-yl]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum |
| SMILES | CN1C=CN(c2[c-]c(C3(c4[c-]c5c(cc4)c4ccccc4n5-c4ccccn4)c4ccccc4-c4ccccc43)ccc2)[CH-]1.[Pt] |
| InChI | InChI=1S/C40H27N4.Pt/c1-42-23-24-43(27-42)30-12-10-11-28(25-30)40(35-16-5-2-13-31(35)32-14-3-6-17-36(32)40)29-20-21-34-33-15-4-7-18-37(33)44(38(34)26-29)39-19-8-9-22-41-39;/h2-24,27H,1H3;/q-3; |
| InChIKey | BSOHEGIJINEDAR-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.76 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|