C36H26O — CID 169044138
2,3,4,5-tetradeuterio-6-[10-(4-naphthalen-1-ylcyclohexa-1,5-dien-1-yl)anthracen-9-yl]phenol (PubChem CID 169044138) has the molecular formula C36H26O and a molecular weight of 478.63 g/mol. Its IUPAC name is 2,3,4,5-tetradeuterio-6-[10-(4-naphthalen-1-ylcyclohexa-1,5-dien-1-yl)anthracen-9-yl]phenol.
| Compound Name | 2,3,4,5-tetradeuterio-6-[10-(4-naphthalen-1-ylcyclohexa-1,5-dien-1-yl)anthracen-9-yl]phenol |
|---|---|
| PubChem CID | 169044138 |
| Molecular Formula | C36H26O |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 2,3,4,5-tetradeuterio-6-[10-(4-naphthalen-1-ylcyclohexa-1,5-dien-1-yl)anthracen-9-yl]phenol |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3ccccc3c(C3=CCC(c4cccc5ccccc45)C=C3)c3ccccc23)c(O)c1[2H] |
| InChI | InChI=1S/C36H26O/c37-34-19-8-7-17-33(34)36-31-15-5-3-13-29(31)35(30-14-4-6-16-32(30)36)26-22-20-25(21-23-26)28-18-9-11-24-10-1-2-12-27(24)28/h1-20,22-23,25,37H,21H2/i7D,8D,17D,19D |
| InChIKey | GOXPVPUVNMFMSL-VULHDTPVSA-N |
| XLogP | 9.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|