C34H52FNO3S — CID 169045665
(2R,4aS,6aS,6aS,14aS,14bR)-10-(2-fluoroethoxy)-11-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-8-propan-2-ylsulfanyl-3,4,5,6,8,8a,12a,13,14,14b-decahydro-1H-picene-2-carboxamide (PubChem CID 169045665) has the molecular formula C34H52FNO3S and a molecular weight of 573.86 g/mol. Its IUPAC name is (2R,4aS,6aS,6aS,14aS,14bR)-10-(2-fluoroethoxy)-11-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-8-propan-2-ylsulfanyl-3,4,5,6,8,8a,12a,13,14,14b-decahydro-1H-picene-2-carboxamide.
| Compound Name | (2R,4aS,6aS,6aS,14aS,14bR)-10-(2-fluoroethoxy)-11-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-8-propan-2-ylsulfanyl-3,4,5,6,8,8a,12a,13,14,14b-decahydro-1H-picene-2-carboxamide |
|---|---|
| PubChem CID | 169045665 |
| Molecular Formula | C34H52FNO3S |
| Molecular Weight | 573.86 g/mol |
| Exact Mass | 573.37 |
| IUPAC Name | (2R,4aS,6aS,6aS,14aS,14bR)-10-(2-fluoroethoxy)-11-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-8-propan-2-ylsulfanyl-3,4,5,6,8,8a,12a,13,14,14b-decahydro-1H-picene-2-carboxamide |
| SMILES | CC1=C(OCCF)C(O)=CC2C1C(SC(C)C)C=C1[C@@]2(C)CC[C@@]2(C)[C@@H]3C[C@](C)(C(N)=O)CC[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C34H52FNO3S/c1-20(2)40-24-18-25-32(6,22-17-23(37)28(39-16-15-35)21(3)27(22)24)12-14-34(8)26-19-31(5,29(36)38)10-9-30(26,4)11-13-33(25,34)7/h17-18,20,22,24,26-27,37H,9-16,19H2,1-8H3,(H2,36,38)/t22?,24?,26-,27?,30-,31-,32+,33-,34+/m1/s1 |
| InChIKey | GZJXTQGOZAQWRQ-CNCWUAFNSA-N |
| XLogP | 8.29 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.86 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|