C28H33F3N2O4 — CID 169046253
ethyl 5-[[3,5-dimethyl-4-(2,2,2-trifluoroethoxycarbonyl)-1H-pyrrol-2-yl]-(2,4,6-trimethylphenyl)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 169046253) has the molecular formula C28H33F3N2O4 and a molecular weight of 518.58 g/mol. Its IUPAC name is ethyl 5-[[3,5-dimethyl-4-(2,2,2-trifluoroethoxycarbonyl)-1H-pyrrol-2-yl]-(2,4,6-trimethylphenyl)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-[[3,5-dimethyl-4-(2,2,2-trifluoroethoxycarbonyl)-1H-pyrrol-2-yl]-(2,4,6-trimethylphenyl)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 169046253 |
| Molecular Formula | C28H33F3N2O4 |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | ethyl 5-[[3,5-dimethyl-4-(2,2,2-trifluoroethoxycarbonyl)-1H-pyrrol-2-yl]-(2,4,6-trimethylphenyl)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C(c2[nH]c(C)c(C(=O)OCC(F)(F)F)c2C)c2c(C)cc(C)cc2C)c1C |
| InChI | InChI=1S/C28H33F3N2O4/c1-9-36-26(34)21-16(5)24(32-18(21)7)23(20-14(3)10-13(2)11-15(20)4)25-17(6)22(19(8)33-25)27(35)37-12-28(29,30)31/h10-11,23,32-33H,9,12H2,1-8H3 |
| InChIKey | BTPBKDSGIBQZQK-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |