About tert-butyl N-[6-[(2R)-2-(2-amino-1,3-thiazol-4-yl)pyrrolidin-1-yl]-3-pyridinyl]carbamate
tert-butyl N-[6-[(2R)-2-(2-amino-1,3-thiazol-4-yl)pyrrolidin-1-yl]-3-pyridinyl]carbamate (PubChem CID 169049392) has the molecular formula C17H23N5O2S
and a molecular weight of 361.47 g/mol. Its IUPAC name is tert-butyl N-[6-[(2R)-2-(2-amino-1,3-thiazol-4-yl)pyrrolidin-1-yl]-3-pyridinyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[6-[(2R)-2-(2-amino-1,3-thiazol-4-yl)pyrrolidin-1-yl]-3-pyridinyl]carbamate |
| PubChem CID | 169049392 |
| Molecular Formula | C17H23N5O2S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | tert-butyl N-[6-[(2R)-2-(2-amino-1,3-thiazol-4-yl)pyrrolidin-1-yl]-3-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(N2CCC[C@@H]2c2csc(N)n2)nc1 |
| InChI | InChI=1S/C17H23N5O2S/c1-17(2,3)24-16(23)20-11-6-7-14(19-9-11)22-8-4-5-13(22)12-10-25-15(18)21-12/h6-7,9-10,13H,4-5,8H2,1-3H3,(H2,18,21)(H,20,23)/t13-/m1/s1 |
| InChIKey | JHUNXHCEEBRMTB-CYBMUJFWSA-N |
| XLogP | 3.81 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tert-butyl N-[6-[(2R)-2-(2-amino-1,3-thiazol-4-yl)pyrrolidin-1-yl]-3-pyridinyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[6-[(2R)-2-(2-amino-1,3-thiazol-4-yl)pyrrolidin-1-yl]-3-pyridinyl]carbamate?
The IUPAC name of tert-butyl N-[6-[(2R)-2-(2-amino-1,3-thiazol-4-yl)pyrrolidin-1-yl]-3-pyridinyl]carbamate (CID 169049392) is tert-butyl N-[6-[(2R)-2-(2-amino-1,3-thiazol-4-yl)pyrrolidin-1-yl]-3-pyridinyl]carbamate.
What is the SMILES notation for tert-butyl N-[6-[(2R)-2-(2-amino-1,3-thiazol-4-yl)pyrrolidin-1-yl]-3-pyridinyl]carbamate?
The canonical SMILES for tert-butyl N-[6-[(2R)-2-(2-amino-1,3-thiazol-4-yl)pyrrolidin-1-yl]-3-pyridinyl]carbamate is CC(C)(C)OC(=O)Nc1ccc(N2CCC[C@@H]2c2csc(N)n2)nc1.
What is the InChIKey of tert-butyl N-[6-[(2R)-2-(2-amino-1,3-thiazol-4-yl)pyrrolidin-1-yl]-3-pyridinyl]carbamate?
The InChIKey is JHUNXHCEEBRMTB-CYBMUJFWSA-N. The full InChI is InChI=1S/C17H23N5O2S/c1-17(2,3)24-16(23)20-11-6-7-14(19-9-11)22-8-4-5-13(22)12-10-25-15(18)21-12/h6-7,9-10,13H,4-5,8H2,1-3H3,(H2,18,21)(H,20,23)/t13-/m1/s1.
What are the key properties of tert-butyl N-[6-[(2R)-2-(2-amino-1,3-thiazol-4-yl)pyrrolidin-1-yl]-3-pyridinyl]carbamate?
tert-butyl N-[6-[(2R)-2-(2-amino-1,3-thiazol-4-yl)pyrrolidin-1-yl]-3-pyridinyl]carbamate has a molecular weight of 361.47 g/mol, XLogP of 3.81, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[6-[(2R)-2-(2-amino-1,3-thiazol-4-yl)pyrrolidin-1-yl]-3-pyridinyl]carbamate is sourced from PubChem (CID 169049392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).